C29H24ClN5O4 — CID 19512743
N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-(1,3,5-trimethylpyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 19512743) has the molecular formula C29H24ClN5O4 and a molecular weight of 542.00 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-(1,3,5-trimethylpyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-(1,3,5-trimethylpyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19512743 |
| Molecular Formula | C29H24ClN5O4 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-(1,3,5-trimethylpyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | Cc1cc(Oc2cc(NC(=O)c3cc(-c4c(C)nn(C)c4C)nc4ccccc34)cc([N+](=O)[O-])c2)ccc1Cl |
| InChI | InChI=1S/C29H24ClN5O4/c1-16-11-21(9-10-25(16)30)39-22-13-19(12-20(14-22)35(37)38)31-29(36)24-15-27(28-17(2)33-34(4)18(28)3)32-26-8-6-5-7-23(24)26/h5-15H,1-4H3,(H,31,36) |
| InChIKey | BIAGIHHPNNVEEG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|