C28H22ClN5O4 — CID 19511958
N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 19511958) has the molecular formula C28H22ClN5O4 and a molecular weight of 527.97 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19511958 |
| Molecular Formula | C28H22ClN5O4 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2cc(-c3cn(C)nc3C)nc3ccccc23)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H22ClN5O4/c1-16-10-18(29)8-9-27(16)38-21-12-19(11-20(13-21)34(36)37)30-28(35)23-14-26(24-15-33(3)32-17(24)2)31-25-7-5-4-6-22(23)25/h4-15H,1-3H3,(H,30,35) |
| InChIKey | VDNKBISYWBPSDX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|