C35H30ClN3O5 — CID 3107711
N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 3107711) has the molecular formula C35H30ClN3O5 and a molecular weight of 608.09 g/mol. Its IUPAC name is N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3107711 |
| Molecular Formula | C35H30ClN3O5 |
| Molecular Weight | 608.09 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cc(Oc4ccc(Cl)cc4C4CCCCC4)cc([N+](=O)[O-])c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C35H30ClN3O5/c1-43-27-14-11-23(12-15-27)33-21-31(29-9-5-6-10-32(29)38-33)35(40)37-25-18-26(39(41)42)20-28(19-25)44-34-16-13-24(36)17-30(34)22-7-3-2-4-8-22/h5-6,9-22H,2-4,7-8H2,1H3,(H,37,40) |
| InChIKey | XXPZDVVWLABDJM-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.09 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|