C20H17N5O3S — CID 19521216
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide (PubChem CID 19521216) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19521216 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)Cn4nc([N+](=O)[O-])cc4C)cc3)sc2c1 |
| InChI | InChI=1S/C20H17N5O3S/c1-12-3-8-16-17(9-12)29-20(22-16)14-4-6-15(7-5-14)21-19(26)11-24-13(2)10-18(23-24)25(27)28/h3-10H,11H2,1-2H3,(H,21,26) |
| InChIKey | AZHIGAAHIAXUCO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|