C20H17F3N8O4S — CID 19522373
4-(1,5-dimethylpyrazol-4-yl)-3-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19522373) has the molecular formula C20H17F3N8O4S and a molecular weight of 522.47 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-3-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-3-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19522373 |
| Molecular Formula | C20H17F3N8O4S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-3-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1nn(CC(=O)Nc2c(C(N)=O)sc3nc(C(F)(F)F)cc(-c4cnn(C)c4C)c23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17F3N8O4S/c1-8-12(31(34)35)6-30(28-8)7-14(32)27-16-15-10(11-5-25-29(3)9(11)2)4-13(20(21,22)23)26-19(15)36-17(16)18(24)33/h4-6H,7H2,1-3H3,(H2,24,33)(H,27,32) |
| InChIKey | KEYXVDNODCAURM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|