C22H21F3N8O4S — CID 19540012
4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19540012) has the molecular formula C22H21F3N8O4S and a molecular weight of 550.52 g/mol. Its IUPAC name is 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19540012 |
| Molecular Formula | C22H21F3N8O4S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(3-methyl-4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1cc(-c2cc(C(F)(F)F)nc3sc(C(N)=O)c(NC(=O)CCn4cc([N+](=O)[O-])c(C)n4)c23)c(C)n1 |
| InChI | InChI=1S/C22H21F3N8O4S/c1-4-31-8-13(10(2)29-31)12-7-15(22(23,24)25)27-21-17(12)18(19(38-21)20(26)35)28-16(34)5-6-32-9-14(33(36)37)11(3)30-32/h7-9H,4-6H2,1-3H3,(H2,26,35)(H,28,34) |
| InChIKey | GOGVNNGINHVMLE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|