C21H19F3N8O4S — CID 19555688
4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19555688) has the molecular formula C21H19F3N8O4S and a molecular weight of 536.50 g/mol. Its IUPAC name is 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19555688 |
| Molecular Formula | C21H19F3N8O4S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 4-(1-ethyl-3-methylpyrazol-4-yl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1cc(-c2cc(C(F)(F)F)nc3sc(C(N)=O)c(NC(=O)CCn4cc([N+](=O)[O-])cn4)c23)c(C)n1 |
| InChI | InChI=1S/C21H19F3N8O4S/c1-3-30-9-13(10(2)29-30)12-6-14(21(22,23)24)27-20-16(12)17(18(37-20)19(25)34)28-15(33)4-5-31-8-11(7-26-31)32(35)36/h6-9H,3-5H2,1-2H3,(H2,25,34)(H,28,33) |
| InChIKey | CVSHGSFEGXRMST-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|