C18H18Cl2F3N5O3 — CID 19527787
1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 19527787) has the molecular formula C18H18Cl2F3N5O3 and a molecular weight of 480.27 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 19527787 |
| Molecular Formula | C18H18Cl2F3N5O3 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H18Cl2F3N5O3/c1-11-16(28(30)31)17(18(21,22)23)24-27(11)10-15(29)26-6-4-25(5-7-26)9-12-2-3-13(19)8-14(12)20/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | QEUFHZGAVSCTQJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|