C20H25Cl2N5O3 — CID 19540217
1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one (PubChem CID 19540217) has the molecular formula C20H25Cl2N5O3 and a molecular weight of 454.36 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 19540217 |
| Molecular Formula | C20H25Cl2N5O3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropan-1-one |
| SMILES | Cc1nn(CC(C)C(=O)N2CCN(Cc3ccc(Cl)cc3Cl)CC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25Cl2N5O3/c1-13(11-26-15(3)19(27(29)30)14(2)23-26)20(28)25-8-6-24(7-9-25)12-16-4-5-17(21)10-18(16)22/h4-5,10,13H,6-9,11-12H2,1-3H3 |
| InChIKey | DGZXLMJYEJKLRU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|