C16H16N4O7 — CID 19530422
dimethyl 5-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 19530422) has the molecular formula C16H16N4O7 and a molecular weight of 376.33 g/mol. Its IUPAC name is dimethyl 5-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19530422 |
| Molecular Formula | C16H16N4O7 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | dimethyl 5-[[2-(3-methyl-5-nitropyrazol-1-yl)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)Cn2nc(C)cc2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H16N4O7/c1-9-4-14(20(24)25)19(18-9)8-13(21)17-12-6-10(15(22)26-2)5-11(7-12)16(23)27-3/h4-7H,8H2,1-3H3,(H,17,21) |
| InChIKey | JDWWULUDRMIHGD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|