C15H14N6O5S2 — CID 19530453
2-(3-methyl-5-nitropyrazol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 19530453) has the molecular formula C15H14N6O5S2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-(3-methyl-5-nitropyrazol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(3-methyl-5-nitropyrazol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19530453 |
| Molecular Formula | C15H14N6O5S2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-(3-methyl-5-nitropyrazol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])n(CC(=O)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)n1 |
| InChI | InChI=1S/C15H14N6O5S2/c1-10-8-14(21(23)24)20(18-10)9-13(22)17-11-2-4-12(5-3-11)28(25,26)19-15-16-6-7-27-15/h2-8H,9H2,1H3,(H,16,19)(H,17,22) |
| InChIKey | MGEQFPKJVQVRIO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|