C20H17ClN4O3S2 — CID 88544020
2-(5-chloro-2-methylindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 88544020) has the molecular formula C20H17ClN4O3S2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 2-(5-chloro-2-methylindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(5-chloro-2-methylindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 88544020 |
| Molecular Formula | C20H17ClN4O3S2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-(5-chloro-2-methylindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1cc2cc(Cl)ccc2n1CC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C20H17ClN4O3S2/c1-13-10-14-11-15(21)2-7-18(14)25(13)12-19(26)23-16-3-5-17(6-4-16)30(27,28)24-20-22-8-9-29-20/h2-11H,12H2,1H3,(H,22,24)(H,23,26) |
| InChIKey | RSFXLMKWHVARFT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |