C19H15FN4O3S2 — CID 88544010
2-(4-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 88544010) has the molecular formula C19H15FN4O3S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-(4-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 88544010 |
| Molecular Formula | C19H15FN4O3S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-(4-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Cn1ccc2c(F)cccc21)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C19H15FN4O3S2/c20-16-2-1-3-17-15(16)8-10-24(17)12-18(25)22-13-4-6-14(7-5-13)29(26,27)23-19-21-9-11-28-19/h1-11H,12H2,(H,21,23)(H,22,25) |
| InChIKey | JGLNDCPBRUWQNG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |