C20H16FN3O3S2 — CID 149496735
2-(7-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide (PubChem CID 149496735) has the molecular formula C20H16FN3O3S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-(7-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(7-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 149496735 |
| Molecular Formula | C20H16FN3O3S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-(7-fluoroindol-1-yl)-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(Cn1ccc2cccc(F)c21)Nc1ccc(S(=O)(=O)Cc2nccs2)cc1 |
| InChI | InChI=1S/C20H16FN3O3S2/c21-17-3-1-2-14-8-10-24(20(14)17)12-18(25)23-15-4-6-16(7-5-15)29(26,27)13-19-22-9-11-28-19/h1-11H,12-13H2,(H,23,25) |
| InChIKey | ZGEKGMNLPYHBOD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |