C22H18N2O6S2 — CID 158590550
2-(4-methyl-2-oxochromen-7-yl)oxy-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide (PubChem CID 158590550) has the molecular formula C22H18N2O6S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 158590550 |
| Molecular Formula | C22H18N2O6S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[4-(1,3-thiazol-2-ylmethylsulfonyl)phenyl]acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3ccc(S(=O)(=O)Cc4nccs4)cc3)ccc12 |
| InChI | InChI=1S/C22H18N2O6S2/c1-14-10-22(26)30-19-11-16(4-7-18(14)19)29-12-20(25)24-15-2-5-17(6-3-15)32(27,28)13-21-23-8-9-31-21/h2-11H,12-13H2,1H3,(H,24,25) |
| InChIKey | HUJUWFAYJMMKNF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|