C20H15Cl2F3N4O4 — CID 19531909
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-chlorophenoxy)-5-nitrophenyl]propanamide (PubChem CID 19531909) has the molecular formula C20H15Cl2F3N4O4 and a molecular weight of 503.26 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-chlorophenoxy)-5-nitrophenyl]propanamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-chlorophenoxy)-5-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 19531909 |
| Molecular Formula | C20H15Cl2F3N4O4 |
| Molecular Weight | 503.26 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-chlorophenoxy)-5-nitrophenyl]propanamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1C(C)C(=O)Nc1cc(Oc2ccc(Cl)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15Cl2F3N4O4/c1-10-17(22)18(20(23,24)25)27-28(10)11(2)19(30)26-13-7-14(29(31)32)9-16(8-13)33-15-5-3-12(21)4-6-15/h3-9,11H,1-2H3,(H,26,30) |
| InChIKey | PIWPRXLFWKLGQG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.26 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|