C15H13ClF3N5O5 — CID 19531974
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)propanamide (PubChem CID 19531974) has the molecular formula C15H13ClF3N5O5 and a molecular weight of 435.75 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)propanamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)propanamide |
|---|---|
| PubChem CID | 19531974 |
| Molecular Formula | C15H13ClF3N5O5 |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)propanamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)C(C)n2nc(C(F)(F)F)c(Cl)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClF3N5O5/c1-6-10(23(26)27)4-9(5-11(6)24(28)29)20-14(25)8(3)22-7(2)12(16)13(21-22)15(17,18)19/h4-5,8H,1-3H3,(H,20,25) |
| InChIKey | JGEFBCBARUOVGU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|