C21H18ClF3N4O4 — CID 19531915
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]propanamide (PubChem CID 19531915) has the molecular formula C21H18ClF3N4O4 and a molecular weight of 482.85 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]propanamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 19531915 |
| Molecular Formula | C21H18ClF3N4O4 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(4-methylphenoxy)-5-nitrophenyl]propanamide |
| SMILES | Cc1ccc(Oc2cc(NC(=O)C(C)n3nc(C(F)(F)F)c(Cl)c3C)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H18ClF3N4O4/c1-11-4-6-16(7-5-11)33-17-9-14(8-15(10-17)29(31)32)26-20(30)13(3)28-12(2)18(22)19(27-28)21(23,24)25/h4-10,13H,1-3H3,(H,26,30) |
| InChIKey | KNRDCZDQZQBYAC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|