C15H13F2N5O4 — CID 19542351
2-[4-(difluoromethoxy)phenyl]-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole (PubChem CID 19542351) has the molecular formula C15H13F2N5O4 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19542351 |
| Molecular Formula | C15H13F2N5O4 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
| SMILES | Cc1nn(Cc2nnc(-c3ccc(OC(F)F)cc3)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13F2N5O4/c1-8-13(22(23)24)9(2)21(20-8)7-12-18-19-14(26-12)10-3-5-11(6-4-10)25-15(16)17/h3-6,15H,7H2,1-2H3 |
| InChIKey | VXAWCGAESXNDGR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|