C15H19N7O3 — CID 19542346
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-5-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 19542346) has the molecular formula C15H19N7O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-5-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-5-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19542346 |
| Molecular Formula | C15H19N7O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-5-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | Cc1cc(C)n(CCc2nnc(Cn3nc(C)c([N+](=O)[O-])c3C)o2)n1 |
| InChI | InChI=1S/C15H19N7O3/c1-9-7-10(2)20(18-9)6-5-13-16-17-14(25-13)8-21-12(4)15(22(23)24)11(3)19-21/h7H,5-6,8H2,1-4H3 |
| InChIKey | QAUUMCCBWFUATP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 117.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|