C13H15N7O3 — CID 19550634
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole (PubChem CID 19550634) has the molecular formula C13H15N7O3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19550634 |
| Molecular Formula | C13H15N7O3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
| SMILES | Cc1cc(C)n(CCc2nnc(Cn3ccc([N+](=O)[O-])n3)o2)n1 |
| InChI | InChI=1S/C13H15N7O3/c1-9-7-10(2)19(16-9)6-4-12-14-15-13(23-12)8-18-5-3-11(17-18)20(21)22/h3,5,7H,4,6,8H2,1-2H3 |
| InChIKey | QMGGKVQGLCDVOA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 117.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|