C13H14N8O5 — CID 19552412
2-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 19552412) has the molecular formula C13H14N8O5 and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19552412 |
| Molecular Formula | C13H14N8O5 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[2-(5-methyl-3-nitropyrazol-1-yl)ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | Cc1cc([N+](=O)[O-])nn1CCc1nnc(CCn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C13H14N8O5/c1-9-6-11(21(24)25)17-19(9)5-3-13-16-15-12(26-13)2-4-18-8-10(7-14-18)20(22)23/h6-8H,2-5H2,1H3 |
| InChIKey | MOLJRDJNXALFLO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 160.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|