C11H10IN7O3 — CID 19540468
2-(4-iodo-1-methylpyrazol-3-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 19540468) has the molecular formula C11H10IN7O3 and a molecular weight of 415.15 g/mol. Its IUPAC name is 2-(4-iodo-1-methylpyrazol-3-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-iodo-1-methylpyrazol-3-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19540468 |
| Molecular Formula | C11H10IN7O3 |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-(4-iodo-1-methylpyrazol-3-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | Cn1cc(I)c(-c2nnc(CCn3cc([N+](=O)[O-])cn3)o2)n1 |
| InChI | InChI=1S/C11H10IN7O3/c1-17-6-8(12)10(16-17)11-15-14-9(22-11)2-3-18-5-7(4-13-18)19(20)21/h4-6H,2-3H2,1H3 |
| InChIKey | ZIXPZTXQVKSLOT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 117.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|