C11H10N8O6 — CID 19542274
2-(3-methoxy-4-nitro-1H-pyrazol-5-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 19542274) has the molecular formula C11H10N8O6 and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-(3-methoxy-4-nitro-1H-pyrazol-5-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-methoxy-4-nitro-1H-pyrazol-5-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19542274 |
| Molecular Formula | C11H10N8O6 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-(3-methoxy-4-nitro-1H-pyrazol-5-yl)-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | COc1n[nH]c(-c2nnc(CCn3cc([N+](=O)[O-])cn3)o2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N8O6/c1-24-11-9(19(22)23)8(14-16-11)10-15-13-7(25-10)2-3-17-5-6(4-12-17)18(20)21/h4-5H,2-3H2,1H3,(H,14,16) |
| InChIKey | GNBBHBIVOGOOSL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|