C17H15F4N5O4 — CID 19542427
2-[2-(4-nitropyrazol-1-yl)ethyl]-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 19542427) has the molecular formula C17H15F4N5O4 and a molecular weight of 429.33 g/mol. Its IUPAC name is 2-[2-(4-nitropyrazol-1-yl)ethyl]-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-nitropyrazol-1-yl)ethyl]-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19542427 |
| Molecular Formula | C17H15F4N5O4 |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-[2-(4-nitropyrazol-1-yl)ethyl]-5-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cnn(CCc2nnc(-c3cccc(COCC(F)(F)C(F)F)c3)o2)c1 |
| InChI | InChI=1S/C17H15F4N5O4/c18-16(19)17(20,21)10-29-9-11-2-1-3-12(6-11)15-24-23-14(30-15)4-5-25-8-13(7-22-25)26(27)28/h1-3,6-8,16H,4-5,9-10H2 |
| InChIKey | LDTWYKMAXWBPEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|