C16H15ClF3N7O3 — CID 19552597
2-[2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 19552597) has the molecular formula C16H15ClF3N7O3 and a molecular weight of 445.79 g/mol. Its IUPAC name is 2-[2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19552597 |
| Molecular Formula | C16H15ClF3N7O3 |
| Molecular Weight | 445.79 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[2-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cnn(CCc2nnc(CCn3nc(C(F)(F)F)c(Cl)c3C3CC3)o2)c1 |
| InChI | InChI=1S/C16H15ClF3N7O3/c17-13-14(9-1-2-9)26(24-15(13)16(18,19)20)6-4-12-23-22-11(30-12)3-5-25-8-10(7-21-25)27(28)29/h7-9H,1-6H2 |
| InChIKey | BFMTXESYBYGOTD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 117.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|