C16H16N4O4 — CID 18273032
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-2-(4-methoxyphenyl)-1,3-oxazole (PubChem CID 18273032) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-2-(4-methoxyphenyl)-1,3-oxazole.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-2-(4-methoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 18273032 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-2-(4-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2nc(Cn3nc(C)c([N+](=O)[O-])c3C)co2)cc1 |
| InChI | InChI=1S/C16H16N4O4/c1-10-15(20(21)22)11(2)19(18-10)8-13-9-24-16(17-13)12-4-6-14(23-3)7-5-12/h4-7,9H,8H2,1-3H3 |
| InChIKey | WBLXPXZEYBXTRJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|