C27H26N2O4S — CID 19546038
(5E)-5-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546038) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is (5E)-5-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546038 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (5E)-5-[[3-[(3,4-diethoxyphenyl)methoxy]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(COc2cccc(/C=C3/NC(=S)N(c4ccccc4)C3=O)c2)cc1OCC |
| InChI | InChI=1S/C27H26N2O4S/c1-3-31-24-14-13-20(17-25(24)32-4-2)18-33-22-12-8-9-19(15-22)16-23-26(30)29(27(34)28-23)21-10-6-5-7-11-21/h5-17H,3-4,18H2,1-2H3,(H,28,34)/b23-16+ |
| InChIKey | SGKSTUZEJSNCQW-XQNSMLJCSA-N |
| XLogP | 5.33 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|