C20H19N3O6S — CID 19546188
(5E)-5-[[5-[(2-nitrophenoxy)methyl]furan-2-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546188) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is (5E)-5-[[5-[(2-nitrophenoxy)methyl]furan-2-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2-nitrophenoxy)methyl]furan-2-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546188 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (5E)-5-[[5-[(2-nitrophenoxy)methyl]furan-2-yl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(COc3ccccc3[N+](=O)[O-])o2)NC(=S)N1CC1CCCO1 |
| InChI | InChI=1S/C20H19N3O6S/c24-19-16(21-20(30)22(19)11-14-4-3-9-27-14)10-13-7-8-15(29-13)12-28-18-6-2-1-5-17(18)23(25)26/h1-2,5-8,10,14H,3-4,9,11-12H2,(H,21,30)/b16-10+ |
| InChIKey | NUZAEMSGPKEETO-MHWRWJLKSA-N |
| XLogP | 3.00 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|