C19H23N3O — CID 19552825
2-(3,5-dimethyl-1-adamantyl)-5-pyridin-2-yl-1,3,4-oxadiazole (PubChem CID 19552825) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-5-pyridin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-5-pyridin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19552825 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-5-pyridin-2-yl-1,3,4-oxadiazole |
| SMILES | CC12CC3CC(C)(C1)CC(c1nnc(-c4ccccn4)o1)(C3)C2 |
| InChI | InChI=1S/C19H23N3O/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)16-22-21-15(23-16)14-5-3-4-6-20-14/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | XHYHDQWUANBVFD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |