C10H8F3NO — CID 19554973
(E)-5,5,5-trifluoro-1-pyridin-3-ylpent-2-en-1-one (PubChem CID 19554973) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-1-pyridin-3-ylpent-2-en-1-one.
| Compound Name | (E)-5,5,5-trifluoro-1-pyridin-3-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 19554973 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (E)-5,5,5-trifluoro-1-pyridin-3-ylpent-2-en-1-one |
| SMILES | O=C(/C=C/CC(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)5-1-4-9(15)8-3-2-6-14-7-8/h1-4,6-7H,5H2/b4-1+ |
| InChIKey | GMOVJBRADAIWGT-DAFODLJHSA-N |
| XLogP | 2.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|