C13H18BrN3O3 — CID 19565725
ethyl (E)-3-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]but-2-enoate (PubChem CID 19565725) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is ethyl (E)-3-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]but-2-enoate.
| Compound Name | ethyl (E)-3-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]but-2-enoate |
|---|---|
| PubChem CID | 19565725 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | ethyl (E)-3-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)CCn1cc(Br)c(C)n1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-4-20-13(19)7-9(2)15-12(18)5-6-17-8-11(14)10(3)16-17/h7-8H,4-6H2,1-3H3,(H,15,18)/b9-7+ |
| InChIKey | AARXEMLXIVLALL-VQHVLOKHSA-N |
| XLogP | 1.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|