C22H22N6O2 — CID 19571487
10-methyl-4-[5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19571487) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 10-methyl-4-[5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-4-[5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19571487 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 10-methyl-4-[5-[(5-methyl-2-propan-2-ylphenoxy)methyl]furan-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1ccc(C(C)C)c(OCc2ccc(-c3nc4c5cnn(C)c5ncn4n3)o2)c1 |
| InChI | InChI=1S/C22H22N6O2/c1-13(2)16-7-5-14(3)9-19(16)29-11-15-6-8-18(30-15)20-25-22-17-10-24-27(4)21(17)23-12-28(22)26-20/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | YIXYWXLVESAWOC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |