C24H30N2O4 — CID 19577478
2-(2-methoxy-4-prop-2-enylphenoxy)-N-[(E)-(4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 19577478) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[(E)-(4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[(E)-(4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19577478 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-[(E)-(4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCc1ccc(OCC(=O)N/N=C/c2ccc(OCCCCC)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-4-6-7-15-29-21-12-9-20(10-13-21)17-25-26-24(27)18-30-22-14-11-19(8-5-2)16-23(22)28-3/h5,9-14,16-17H,2,4,6-8,15,18H2,1,3H3,(H,26,27)/b25-17+ |
| InChIKey | PFKYLMKDUYOXJJ-KOEQRZSOSA-N |
| XLogP | 4.52 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|