C26H24N2O5 — CID 5078894
[4-[[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 5078894) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is [4-[[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5078894 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [4-[[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | C=CCc1ccc(OCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O5/c1-3-7-19-12-15-23(24(16-19)31-2)32-18-25(29)28-27-17-20-10-13-22(14-11-20)33-26(30)21-8-5-4-6-9-21/h3-6,8-17H,1,7,18H2,2H3,(H,28,29) |
| InChIKey | OZSDSJXZVRYIBD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|