C17H17Cl2NO3 — CID 19579030
1,3-dichloropropan-2-yl 4-(naphthalen-1-ylamino)-4-oxobutanoate (PubChem CID 19579030) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl 4-(naphthalen-1-ylamino)-4-oxobutanoate.
| Compound Name | 1,3-dichloropropan-2-yl 4-(naphthalen-1-ylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 19579030 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1,3-dichloropropan-2-yl 4-(naphthalen-1-ylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OC(CCl)CCl)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H17Cl2NO3/c18-10-13(11-19)23-17(22)9-8-16(21)20-15-7-3-5-12-4-1-2-6-14(12)15/h1-7,13H,8-11H2,(H,20,21) |
| InChIKey | AFUSYLAQIPBDJO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|