About N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide
N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19579486) has the molecular formula C15H13N5O3S
and a molecular weight of 343.37 g/mol. Its IUPAC name is N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| PubChem CID | 19579486 |
| Molecular Formula | C15H13N5O3S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3[nH]ncc3[N+](=O)[O-])n2)c(C)c1 |
| InChI | InChI=1S/C15H13N5O3S/c1-8-3-4-10(9(2)5-8)11-7-24-15(17-11)18-14(21)13-12(20(22)23)6-16-19-13/h3-7H,1-2H3,(H,16,19)(H,17,18,21) |
| InChIKey | DLLIYQRDPCLPQU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide?
The IUPAC name of N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide (CID 19579486) is N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide is Cc1ccc(-c2csc(NC(=O)c3[nH]ncc3[N+](=O)[O-])n2)c(C)c1.
What is the InChIKey of N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide?
The InChIKey is DLLIYQRDPCLPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O3S/c1-8-3-4-10(9(2)5-8)11-7-24-15(17-11)18-14(21)13-12(20(22)23)6-16-19-13/h3-7H,1-2H3,(H,16,19)(H,17,18,21).
What are the key properties of N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide?
N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide has a molecular weight of 343.37 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-4-nitro-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 19579486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).