C18H19N7S — CID 19583697
4-(1-benzylpyrazol-4-yl)-3-[1-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 19583697) has the molecular formula C18H19N7S and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-(1-benzylpyrazol-4-yl)-3-[1-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(1-benzylpyrazol-4-yl)-3-[1-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 19583697 |
| Molecular Formula | C18H19N7S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(1-benzylpyrazol-4-yl)-3-[1-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cnn(C(C)c2n[nH]c(=S)n2-c2cnn(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C18H19N7S/c1-13-8-20-24(10-13)14(2)17-21-22-18(26)25(17)16-9-19-23(12-16)11-15-6-4-3-5-7-15/h3-10,12,14H,11H2,1-2H3,(H,22,26) |
| InChIKey | OLFCBLFKHWYZLR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|