C20H14N2O2S — CID 19588009
5-(4-methoxyphenyl)-3-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,8,10,12,14-hexaen-7-one (PubChem CID 19588009) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,8,10,12,14-hexaen-7-one.
| Compound Name | 5-(4-methoxyphenyl)-3-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,8,10,12,14-hexaen-7-one |
|---|---|
| PubChem CID | 19588009 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-thia-1,8-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-2(6),4,8,10,12,14-hexaen-7-one |
| SMILES | COc1ccc(-c2csc3c2c(=O)nc2n3Cc3ccccc3-2)cc1 |
| InChI | InChI=1S/C20H14N2O2S/c1-24-14-8-6-12(7-9-14)16-11-25-20-17(16)19(23)21-18-15-5-3-2-4-13(15)10-22(18)20/h2-9,11H,10H2,1H3 |
| InChIKey | MECDCAIBWNZOPN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |