C17H15F3N2O5 — CID 19597378
2,6-dimethyl-4-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 19597378) has the molecular formula C17H15F3N2O5 and a molecular weight of 384.31 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2,6-dimethyl-4-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 19597378 |
| Molecular Formula | C17H15F3N2O5 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2,6-dimethyl-4-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(NC(=O)C(F)(F)F)c2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C17H15F3N2O5/c1-7-11(14(23)24)13(12(15(25)26)8(2)21-7)9-4-3-5-10(6-9)22-16(27)17(18,19)20/h3-6,13,21H,1-2H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | OBZUBQBNBVOVGZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |