C14H16N2 — CID 19603194
3,7-dimethyl-1,5,6,9-tetrahydropyrido[3,2-g]quinoline (PubChem CID 19603194) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 3,7-dimethyl-1,5,6,9-tetrahydropyrido[3,2-g]quinoline.
| Compound Name | 3,7-dimethyl-1,5,6,9-tetrahydropyrido[3,2-g]quinoline |
|---|---|
| PubChem CID | 19603194 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3,7-dimethyl-1,5,6,9-tetrahydropyrido[3,2-g]quinoline |
| SMILES | CC1=CNC2=CC3=C(CC(C)=CN3)CC2=C1 |
| InChI | InChI=1S/C14H16N2/c1-9-3-11-5-12-4-10(2)8-16-14(12)6-13(11)15-7-9/h3,6-8,15-16H,4-5H2,1-2H3 |
| InChIKey | FQEVGEFRLUUOOH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |