C30H26Cl2N4O5 — CID 19603264
(E)-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]-3-(3-methyl-4-nitrophenyl)prop-2-enamide (PubChem CID 19603264) has the molecular formula C30H26Cl2N4O5 and a molecular weight of 593.47 g/mol. Its IUPAC name is (E)-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]-3-(3-methyl-4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]-3-(3-methyl-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19603264 |
| Molecular Formula | C30H26Cl2N4O5 |
| Molecular Weight | 593.47 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | (E)-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]-3-(3-methyl-4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)/C=C/c4ccc([N+](=O)[O-])c(C)c4)c3Cl)c2n1 |
| InChI | InChI=1S/C30H26Cl2N4O5/c1-18-15-20(8-12-24(18)36(39)40)9-14-27(37)33-16-28(38)35(3)25-13-11-23(31)22(29(25)32)17-41-26-6-4-5-21-10-7-19(2)34-30(21)26/h4-15H,16-17H2,1-3H3,(H,33,37)/b14-9+ |
| InChIKey | VYRIIGANOSSQIM-NTEUORMPSA-N |
| XLogP | 6.44 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|