C11H15NO5S — CID 19603924
4-(cyclohexylcarbamoyl)furan-2-sulfonic acid (PubChem CID 19603924) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoyl)furan-2-sulfonic acid.
| Compound Name | 4-(cyclohexylcarbamoyl)furan-2-sulfonic acid |
|---|---|
| PubChem CID | 19603924 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(cyclohexylcarbamoyl)furan-2-sulfonic acid |
| SMILES | O=C(NC1CCCCC1)c1coc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H15NO5S/c13-11(12-9-4-2-1-3-5-9)8-6-10(17-7-8)18(14,15)16/h6-7,9H,1-5H2,(H,12,13)(H,14,15,16) |
| InChIKey | LNCOAEYUJQHCNB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|