C14H16ClN3O — CID 19604920
2-chloro-N-(2-ethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide (PubChem CID 19604920) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-chloro-N-(2-ethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-(2-ethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide |
|---|---|
| PubChem CID | 19604920 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-chloro-N-(2-ethylphenyl)-N-(pyrazol-1-ylmethyl)acetamide |
| SMILES | CCc1ccccc1N(Cn1cccn1)C(=O)CCl |
| InChI | InChI=1S/C14H16ClN3O/c1-2-12-6-3-4-7-13(12)18(14(19)10-15)11-17-9-5-8-16-17/h3-9H,2,10-11H2,1H3 |
| InChIKey | IGSHWPPJIZMKNH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|