C18H27ClN6O2 — CID 70462051
2-chloro-N-[4-(dimethylamino)-6-hexoxypyrimidin-5-yl]-N-(pyrazol-1-ylmethyl)acetamide (PubChem CID 70462051) has the molecular formula C18H27ClN6O2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-chloro-N-[4-(dimethylamino)-6-hexoxypyrimidin-5-yl]-N-(pyrazol-1-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-[4-(dimethylamino)-6-hexoxypyrimidin-5-yl]-N-(pyrazol-1-ylmethyl)acetamide |
|---|---|
| PubChem CID | 70462051 |
| Molecular Formula | C18H27ClN6O2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-chloro-N-[4-(dimethylamino)-6-hexoxypyrimidin-5-yl]-N-(pyrazol-1-ylmethyl)acetamide |
| SMILES | CCCCCCOc1ncnc(N(C)C)c1N(Cn1cccn1)C(=O)CCl |
| InChI | InChI=1S/C18H27ClN6O2/c1-4-5-6-7-11-27-18-16(17(23(2)3)20-13-21-18)25(15(26)12-19)14-24-10-8-9-22-24/h8-10,13H,4-7,11-12,14H2,1-3H3 |
| InChIKey | VAMLDSGQAQKJMA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|