C14H16N3NaO4S — CID 156613467
sodium 2-oxo-2-[N-(pyrazol-1-ylmethyl)-2,6-bis(trideuteriomethyl)anilino]ethanesulfonate (PubChem CID 156613467) has the molecular formula C14H16N3NaO4S and a molecular weight of 351.39 g/mol. Its IUPAC name is sodium 2-oxo-2-[N-(pyrazol-1-ylmethyl)-2,6-bis(trideuteriomethyl)anilino]ethanesulfonate.
| Compound Name | sodium 2-oxo-2-[N-(pyrazol-1-ylmethyl)-2,6-bis(trideuteriomethyl)anilino]ethanesulfonate |
|---|---|
| PubChem CID | 156613467 |
| Molecular Formula | C14H16N3NaO4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | sodium 2-oxo-2-[N-(pyrazol-1-ylmethyl)-2,6-bis(trideuteriomethyl)anilino]ethanesulfonate |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1N(Cn1cccn1)C(=O)CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H17N3O4S.Na/c1-11-5-3-6-12(2)14(11)17(10-16-8-4-7-15-16)13(18)9-22(19,20)21;/h3-8H,9-10H2,1-2H3,(H,19,20,21);/q;+1/p-1/i1D3,2D3; |
| InChIKey | PCVFIVBODVWPQX-TXHXQZCNSA-M |
| XLogP | -1.96 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|