C22H23N3O3S — CID 19605460
4-[[2-(2-methoxyphenyl)-6-pyrrolidin-1-yl-4-pyridinyl]sulfonyl]aniline (PubChem CID 19605460) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-[[2-(2-methoxyphenyl)-6-pyrrolidin-1-yl-4-pyridinyl]sulfonyl]aniline.
| Compound Name | 4-[[2-(2-methoxyphenyl)-6-pyrrolidin-1-yl-4-pyridinyl]sulfonyl]aniline |
|---|---|
| PubChem CID | 19605460 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[[2-(2-methoxyphenyl)-6-pyrrolidin-1-yl-4-pyridinyl]sulfonyl]aniline |
| SMILES | COc1ccccc1-c1cc(S(=O)(=O)c2ccc(N)cc2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C22H23N3O3S/c1-28-21-7-3-2-6-19(21)20-14-18(15-22(24-20)25-12-4-5-13-25)29(26,27)17-10-8-16(23)9-11-17/h2-3,6-11,14-15H,4-5,12-13,23H2,1H3 |
| InChIKey | QVXAZQISIYTVHB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|