C17H23N5O3S — CID 134149174
4-(2-methoxyphenyl)-6-[4-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine (PubChem CID 134149174) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-6-[4-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-(2-methoxyphenyl)-6-[4-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 134149174 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-(2-methoxyphenyl)-6-[4-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine |
| SMILES | COc1ccccc1-c1cc(N2CCC(CNS(N)(=O)=O)CC2)ncn1 |
| InChI | InChI=1S/C17H23N5O3S/c1-25-16-5-3-2-4-14(16)15-10-17(20-12-19-15)22-8-6-13(7-9-22)11-21-26(18,23)24/h2-5,10,12-13,21H,6-9,11H2,1H3,(H2,18,23,24) |
| InChIKey | NQSWLDIWOLWDCZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |