C17H22FN5O2S — CID 134148683
4-(2-fluorophenyl)-6-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrimidine (PubChem CID 134148683) has the molecular formula C17H22FN5O2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-6-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-(2-fluorophenyl)-6-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 134148683 |
| Molecular Formula | C17H22FN5O2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(2-fluorophenyl)-6-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrimidine |
| SMILES | NS(=O)(=O)NCCC1CCN(c2cc(-c3ccccc3F)ncn2)CC1 |
| InChI | InChI=1S/C17H22FN5O2S/c18-15-4-2-1-3-14(15)16-11-17(21-12-20-16)23-9-6-13(7-10-23)5-8-22-26(19,24)25/h1-4,11-13,22H,5-10H2,(H2,19,24,25) |
| InChIKey | CIMGHJBGHORLSF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |