About dioxido(oxo)phosphanium;zirconium(2+);phosphate
dioxido(oxo)phosphanium;zirconium(2+);phosphate (PubChem CID 19613992) has the molecular formula O7P2Zr-2
and a molecular weight of 265.16 g/mol. Its IUPAC name is dioxido(oxo)phosphanium;zirconium(2+);phosphate.
Molecular Properties
| Compound Name | dioxido(oxo)phosphanium;zirconium(2+);phosphate |
| PubChem CID | 19613992 |
| Molecular Formula | O7P2Zr-2 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 263.82 |
| IUPAC Name | dioxido(oxo)phosphanium;zirconium(2+);phosphate |
| SMILES | O=P([O-])([O-])[O-].O=[P+]([O-])[O-].[Zr+2] |
| InChI | InChI=1S/H3O4P.HO3P.Zr/c1-5(2,3)4;1-4(2)3;/h(H3,1,2,3,4);(H,1,2,3);/q;;+2/p-4 |
| InChIKey | YJWIOKLSZRTSBS-UHFFFAOYSA-J |
| XLogP | -4.46 |
| TPSA | 149.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)phosphanium;zirconium(2+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)phosphanium;zirconium(2+);phosphate?
The IUPAC name of dioxido(oxo)phosphanium;zirconium(2+);phosphate (CID 19613992) is dioxido(oxo)phosphanium;zirconium(2+);phosphate.
What is the SMILES notation for dioxido(oxo)phosphanium;zirconium(2+);phosphate?
The canonical SMILES for dioxido(oxo)phosphanium;zirconium(2+);phosphate is O=P([O-])([O-])[O-].O=[P+]([O-])[O-].[Zr+2].
What is the InChIKey of dioxido(oxo)phosphanium;zirconium(2+);phosphate?
The InChIKey is YJWIOKLSZRTSBS-UHFFFAOYSA-J. The full InChI is InChI=1S/H3O4P.HO3P.Zr/c1-5(2,3)4;1-4(2)3;/h(H3,1,2,3,4);(H,1,2,3);/q;;+2/p-4.
What are the key properties of dioxido(oxo)phosphanium;zirconium(2+);phosphate?
dioxido(oxo)phosphanium;zirconium(2+);phosphate has a molecular weight of 265.16 g/mol, XLogP of -4.46, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)phosphanium;zirconium(2+);phosphate is sourced from PubChem (CID 19613992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).